C20H23FN4O5S — CID 41262550
1-(4-fluorophenyl)sulfonyl-N-[2-(4-nitroanilino)ethyl]piperidine-4-carboxamide (PubChem CID 41262550) has the molecular formula C20H23FN4O5S and a molecular weight of 450.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[2-(4-nitroanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[2-(4-nitroanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41262550 |
| Molecular Formula | C20H23FN4O5S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[2-(4-nitroanilino)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cc1)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H23FN4O5S/c21-16-1-7-19(8-2-16)31(29,30)24-13-9-15(10-14-24)20(26)23-12-11-22-17-3-5-18(6-4-17)25(27)28/h1-8,15,22H,9-14H2,(H,23,26) |
| InChIKey | SVYMUHXPHZBJRO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|