C14H21N5O5S — CID 32562189
N-[2-(4-nitroanilino)ethyl]-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 32562189) has the molecular formula C14H21N5O5S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[2-(4-nitroanilino)ethyl]-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-[2-(4-nitroanilino)ethyl]-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 32562189 |
| Molecular Formula | C14H21N5O5S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[2-(4-nitroanilino)ethyl]-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | NS(=O)(=O)N1CCC(C(=O)NCCNc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C14H21N5O5S/c15-25(23,24)18-9-5-11(6-10-18)14(20)17-8-7-16-12-1-3-13(4-2-12)19(21)22/h1-4,11,16H,5-10H2,(H,17,20)(H2,15,23,24) |
| InChIKey | SCEQQYJDUPUKOU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|