C19H13Cl2N3O5 — CID 1313709
3,5-dichloro-N-(furan-2-ylmethyl)-2-[(3-nitrobenzoyl)amino]benzamide (PubChem CID 1313709) has the molecular formula C19H13Cl2N3O5 and a molecular weight of 434.24 g/mol. Its IUPAC name is 3,5-dichloro-N-(furan-2-ylmethyl)-2-[(3-nitrobenzoyl)amino]benzamide.
| Compound Name | 3,5-dichloro-N-(furan-2-ylmethyl)-2-[(3-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 1313709 |
| Molecular Formula | C19H13Cl2N3O5 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 3,5-dichloro-N-(furan-2-ylmethyl)-2-[(3-nitrobenzoyl)amino]benzamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1C(=O)NCc1ccco1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13Cl2N3O5/c20-12-8-15(19(26)22-10-14-5-2-6-29-14)17(16(21)9-12)23-18(25)11-3-1-4-13(7-11)24(27)28/h1-9H,10H2,(H,22,26)(H,23,25) |
| InChIKey | DFQULGJYOCGHLM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|