C13H21N7O2S — CID 168603179
1-(diaminomethylidene)-2-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]guanidine (PubChem CID 168603179) has the molecular formula C13H21N7O2S and a molecular weight of 339.43 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168603179 |
| Molecular Formula | C13H21N7O2S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]guanidine |
| SMILES | CS(=O)(=O)N1CCN(c2ccccc2/N=C(\N)N=C(N)N)CC1 |
| InChI | InChI=1S/C13H21N7O2S/c1-23(21,22)20-8-6-19(7-9-20)11-5-3-2-4-10(11)17-13(16)18-12(14)15/h2-5H,6-9H2,1H3,(H6,14,15,16,17,18) |
| InChIKey | SIXFDSFLMALGKD-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|