C14H16N4OS — CID 169360799
methyl N-cyano-N'-[2-(pyrrolidine-1-carbonyl)phenyl]carbamimidothioate (PubChem CID 169360799) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-(pyrrolidine-1-carbonyl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-(pyrrolidine-1-carbonyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169360799 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl N-cyano-N'-[2-(pyrrolidine-1-carbonyl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccccc1C(=O)N1CCCC1)NC#N |
| InChI | InChI=1S/C14H16N4OS/c1-20-14(16-10-15)17-12-7-3-2-6-11(12)13(19)18-8-4-5-9-18/h2-3,6-7H,4-5,8-9H2,1H3,(H,16,17) |
| InChIKey | LWWZSIBDNNDBNP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|