C14H18N4O3S2 — CID 169362530
methyl N-cyano-N'-(2-methylsulfonyl-5-morpholin-4-ylphenyl)carbamimidothioate (PubChem CID 169362530) has the molecular formula C14H18N4O3S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is methyl N-cyano-N'-(2-methylsulfonyl-5-morpholin-4-ylphenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(2-methylsulfonyl-5-morpholin-4-ylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169362530 |
| Molecular Formula | C14H18N4O3S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | methyl N-cyano-N'-(2-methylsulfonyl-5-morpholin-4-ylphenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1cc(N2CCOCC2)ccc1S(C)(=O)=O)NC#N |
| InChI | InChI=1S/C14H18N4O3S2/c1-22-14(16-10-15)17-12-9-11(18-5-7-21-8-6-18)3-4-13(12)23(2,19)20/h3-4,9H,5-8H2,1-2H3,(H,16,17) |
| InChIKey | PWNCBFLJCBZHMR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|