C16H22N4S — CID 169361652
methyl N'-[2-(azepan-1-yl)-5-methylphenyl]-N-cyanocarbamimidothioate (PubChem CID 169361652) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is methyl N'-[2-(azepan-1-yl)-5-methylphenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[2-(azepan-1-yl)-5-methylphenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169361652 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | methyl N'-[2-(azepan-1-yl)-5-methylphenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(C)ccc1N1CCCCCC1)NC#N |
| InChI | InChI=1S/C16H22N4S/c1-13-7-8-15(20-9-5-3-4-6-10-20)14(11-13)19-16(21-2)18-12-17/h7-8,11H,3-6,9-10H2,1-2H3,(H,18,19) |
| InChIKey | KCNOSXQGQMXDNA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|