C15H19FN4S — CID 169361999
methyl N'-[4-(azepan-1-yl)-3-fluorophenyl]-N-cyanocarbamimidothioate (PubChem CID 169361999) has the molecular formula C15H19FN4S and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl N'-[4-(azepan-1-yl)-3-fluorophenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[4-(azepan-1-yl)-3-fluorophenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169361999 |
| Molecular Formula | C15H19FN4S |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | methyl N'-[4-(azepan-1-yl)-3-fluorophenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1ccc(N2CCCCCC2)c(F)c1)NC#N |
| InChI | InChI=1S/C15H19FN4S/c1-21-15(18-11-17)19-12-6-7-14(13(16)10-12)20-8-4-2-3-5-9-20/h6-7,10H,2-5,8-9H2,1H3,(H,18,19) |
| InChIKey | OGVCJTZKBGHTID-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|