C13H15N3O2S — CID 169364221
4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]butanoic acid (PubChem CID 169364221) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]butanoic acid.
| Compound Name | 4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 169364221 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]butanoic acid |
| SMILES | CS/C(=N\c1ccccc1CCCC(=O)O)NC#N |
| InChI | InChI=1S/C13H15N3O2S/c1-19-13(15-9-14)16-11-7-3-2-5-10(11)6-4-8-12(17)18/h2-3,5,7H,4,6,8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | HFZLSNMMEYYLQC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|