C10H9N7S — CID 169360804
methyl N-cyano-N'-[2-(tetrazol-1-yl)phenyl]carbamimidothioate (PubChem CID 169360804) has the molecular formula C10H9N7S and a molecular weight of 259.30 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-(tetrazol-1-yl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-(tetrazol-1-yl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169360804 |
| Molecular Formula | C10H9N7S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | methyl N-cyano-N'-[2-(tetrazol-1-yl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccccc1-n1cnnn1)NC#N |
| InChI | InChI=1S/C10H9N7S/c1-18-10(12-6-11)14-8-4-2-3-5-9(8)17-7-13-15-16-17/h2-5,7H,1H3,(H,12,14) |
| InChIKey | JYIQQWXTOCVLQQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|