C26H31F3N2O4 — CID 139936900
[(4-tert-butylcyclohexyl)-[[4-(trifluoromethoxy)benzoyl]amino]amino]methyl benzoate (PubChem CID 139936900) has the molecular formula C26H31F3N2O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is [(4-tert-butylcyclohexyl)-[[4-(trifluoromethoxy)benzoyl]amino]amino]methyl benzoate.
| Compound Name | [(4-tert-butylcyclohexyl)-[[4-(trifluoromethoxy)benzoyl]amino]amino]methyl benzoate |
|---|---|
| PubChem CID | 139936900 |
| Molecular Formula | C26H31F3N2O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [(4-tert-butylcyclohexyl)-[[4-(trifluoromethoxy)benzoyl]amino]amino]methyl benzoate |
| SMILES | CC(C)(C)C1CCC(N(COC(=O)c2ccccc2)NC(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C26H31F3N2O4/c1-25(2,3)20-11-13-21(14-12-20)31(17-34-24(33)19-7-5-4-6-8-19)30-23(32)18-9-15-22(16-10-18)35-26(27,28)29/h4-10,15-16,20-21H,11-14,17H2,1-3H3,(H,30,32) |
| InChIKey | BUJZGSIHHAFMGV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|