C23H28BrNO4S — CID 17343372
methyl 2-[(5-bromo-2-hexoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17343372) has the molecular formula C23H28BrNO4S and a molecular weight of 494.45 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-hexoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(5-bromo-2-hexoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17343372 |
| Molecular Formula | C23H28BrNO4S |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | methyl 2-[(5-bromo-2-hexoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1sc2c(c1C(=O)OC)CCCC2 |
| InChI | InChI=1S/C23H28BrNO4S/c1-3-4-5-8-13-29-18-12-11-15(24)14-17(18)21(26)25-22-20(23(27)28-2)16-9-6-7-10-19(16)30-22/h11-12,14H,3-10,13H2,1-2H3,(H,25,26) |
| InChIKey | QJGKISPENJGBSX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|