C17H14Cl2N2O2S — CID 1395143
(E)-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 1395143) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is (E)-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1395143 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (E)-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C/C(=O)Nc1sc(C)c(C)c1C#N |
| InChI | InChI=1S/C17H14Cl2N2O2S/c1-9-10(2)24-17(13(9)8-20)21-15(22)5-4-11-6-12(18)7-14(19)16(11)23-3/h4-7H,1-3H3,(H,21,22)/b5-4+ |
| InChIKey | CRFGEUSZOYTENB-SNAWJCMRSA-N |
| XLogP | 5.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|