C22H22N2O9S — CID 3901588
2-methoxyethyl 2-[[2-[3-(1,3-benzodioxol-5-yl)prop-2-enoyloxy]acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate (PubChem CID 3901588) has the molecular formula C22H22N2O9S and a molecular weight of 490.49 g/mol. Its IUPAC name is 2-methoxyethyl 2-[[2-[3-(1,3-benzodioxol-5-yl)prop-2-enoyloxy]acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate.
| Compound Name | 2-methoxyethyl 2-[[2-[3-(1,3-benzodioxol-5-yl)prop-2-enoyloxy]acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3901588 |
| Molecular Formula | C22H22N2O9S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-methoxyethyl 2-[[2-[3-(1,3-benzodioxol-5-yl)prop-2-enoyloxy]acetyl]amino]-5-carbamoyl-4-methylthiophene-3-carboxylate |
| SMILES | COCCOC(=O)c1c(NC(=O)COC(=O)C=Cc2ccc3c(c2)OCO3)sc(C(N)=O)c1C |
| InChI | InChI=1S/C22H22N2O9S/c1-12-18(22(28)30-8-7-29-2)21(34-19(12)20(23)27)24-16(25)10-31-17(26)6-4-13-3-5-14-15(9-13)33-11-32-14/h3-6,9H,7-8,10-11H2,1-2H3,(H2,23,27)(H,24,25) |
| InChIKey | NYLCSRTYVURTPJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|