C24H22N2O3S2 — CID 6122269
methyl 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 6122269) has the molecular formula C24H22N2O3S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is methyl 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 6122269 |
| Molecular Formula | C24H22N2O3S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | methyl 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NC(=O)/C=C/c2cccc3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C24H22N2O3S2/c1-29-23(28)21-18-11-4-5-12-19(18)31-22(21)26-24(30)25-20(27)14-13-16-9-6-8-15-7-2-3-10-17(15)16/h2-3,6-10,13-14H,4-5,11-12H2,1H3,(H2,25,26,27,30)/b14-13+ |
| InChIKey | WNOFVBBWGVRPRW-BUHFOSPRSA-N |
| XLogP | 5.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|