C23H24N2O2S2 — CID 166635408
propyl 2-(naphthalen-1-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 166635408) has the molecular formula C23H24N2O2S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is propyl 2-(naphthalen-1-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propyl 2-(naphthalen-1-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 166635408 |
| Molecular Formula | C23H24N2O2S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | propyl 2-(naphthalen-1-ylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=S)Nc2cccc3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C23H24N2O2S2/c1-2-14-27-22(26)20-17-11-5-6-13-19(17)29-21(20)25-23(28)24-18-12-7-9-15-8-3-4-10-16(15)18/h3-4,7-10,12H,2,5-6,11,13-14H2,1H3,(H2,24,25,28) |
| InChIKey | CPOOEJRFBYDPLZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|