C21H21N2O3S+ — CID 8828675
methyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 8828675) has the molecular formula C21H21N2O3S+ and a molecular weight of 381.48 g/mol. Its IUPAC name is methyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 8828675 |
| Molecular Formula | C21H21N2O3S+ |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C[n+]2ccc3ccccc3c2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H20N2O3S/c1-26-21(25)19-16-8-4-5-9-17(16)27-20(19)22-18(24)13-23-11-10-14-6-2-3-7-15(14)12-23/h2-3,6-7,10-12H,4-5,8-9,13H2,1H3/p+1 |
| InChIKey | ZJAOAJAHBGCKBA-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|