C24H23ClN4O4S2 — CID 126347676
ethyl 2-[[2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126347676) has the molecular formula C24H23ClN4O4S2 and a molecular weight of 531.06 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126347676 |
| Molecular Formula | C24H23ClN4O4S2 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | ethyl 2-[[2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(-c3cc4cc(Cl)ccc4o3)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C24H23ClN4O4S2/c1-3-32-23(31)20-15-6-4-5-7-18(15)35-22(20)26-19(30)12-34-24-28-27-21(29(24)2)17-11-13-10-14(25)8-9-16(13)33-17/h8-11H,3-7,12H2,1-2H3,(H,26,30) |
| InChIKey | DZCFONCZPVLGCX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |