C25H30N4O4S2 — CID 19731810
propan-2-yl 2-[[2-[[5-(2-ethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19731810) has the molecular formula C25H30N4O4S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[[5-(2-ethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[2-[[5-(2-ethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19731810 |
| Molecular Formula | C25H30N4O4S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | propan-2-yl 2-[[2-[[5-(2-ethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOc1ccccc1-c1nnc(SCC(=O)Nc2sc3c(c2C(=O)OC(C)C)CCCC3)n1C |
| InChI | InChI=1S/C25H30N4O4S2/c1-5-32-18-12-8-6-10-16(18)22-27-28-25(29(22)4)34-14-20(30)26-23-21(24(31)33-15(2)3)17-11-7-9-13-19(17)35-23/h6,8,10,12,15H,5,7,9,11,13-14H2,1-4H3,(H,26,30) |
| InChIKey | ZTOYQTUXANHJLS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |