C32H31N5O3S2 — CID 19727296
propan-2-yl 2-[[2-[[4-methyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19727296) has the molecular formula C32H31N5O3S2 and a molecular weight of 597.77 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[[4-methyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[2-[[4-methyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19727296 |
| Molecular Formula | C32H31N5O3S2 |
| Molecular Weight | 597.77 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | propan-2-yl 2-[[2-[[4-methyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)CSc2nnc(-c3cc(-c4ccccc4)nc4ccccc34)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C32H31N5O3S2/c1-19(2)40-31(39)28-22-14-8-10-16-26(22)42-30(28)34-27(38)18-41-32-36-35-29(37(32)3)23-17-25(20-11-5-4-6-12-20)33-24-15-9-7-13-21(23)24/h4-7,9,11-13,15,17,19H,8,10,14,16,18H2,1-3H3,(H,34,38) |
| InChIKey | OJIJIEZUSCLSTC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |