C27H33N5O4S2 — CID 126355431
ethyl 2-[[2-[[5-[(1R)-1-benzamido-2-methylpropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126355431) has the molecular formula C27H33N5O4S2 and a molecular weight of 555.73 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(1R)-1-benzamido-2-methylpropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(1R)-1-benzamido-2-methylpropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126355431 |
| Molecular Formula | C27H33N5O4S2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | ethyl 2-[[2-[[5-[(1R)-1-benzamido-2-methylpropyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc([C@H](NC(=O)c3ccccc3)C(C)C)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C27H33N5O4S2/c1-5-36-26(35)21-18-13-9-10-14-19(18)38-25(21)28-20(33)15-37-27-31-30-23(32(27)4)22(16(2)3)29-24(34)17-11-7-6-8-12-17/h6-8,11-12,16,22H,5,9-10,13-15H2,1-4H3,(H,28,33)(H,29,34)/t22-/m1/s1 |
| InChIKey | RAKBAHWEYWRPLK-JOCHJYFZSA-N |
| XLogP | 4.79 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |