C23H26FN5O3S2 — CID 19640431
2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19640431) has the molecular formula C23H26FN5O3S2 and a molecular weight of 503.63 g/mol. Its IUPAC name is 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19640431 |
| Molecular Formula | C23H26FN5O3S2 |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-[[2-[[5-[1-(4-fluorophenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)CSc3nnc(C(C)Oc4ccc(F)cc4)n3C)c2C(N)=O)C1 |
| InChI | InChI=1S/C23H26FN5O3S2/c1-12-4-9-16-17(10-12)34-22(19(16)20(25)31)26-18(30)11-33-23-28-27-21(29(23)3)13(2)32-15-7-5-14(24)6-8-15/h5-8,12-13H,4,9-11H2,1-3H3,(H2,25,31)(H,26,30) |
| InChIKey | QGICJRGULRRRSZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |