C22H24ClN5O3S2 — CID 19631808
2-[[2-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19631808) has the molecular formula C22H24ClN5O3S2 and a molecular weight of 506.05 g/mol. Its IUPAC name is 2-[[2-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19631808 |
| Molecular Formula | C22H24ClN5O3S2 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 2-[[2-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)CSc3nnc(COc4ccccc4Cl)n3C)c2C(N)=O)C1 |
| InChI | InChI=1S/C22H24ClN5O3S2/c1-12-7-8-13-16(9-12)33-21(19(13)20(24)30)25-18(29)11-32-22-27-26-17(28(22)2)10-31-15-6-4-3-5-14(15)23/h3-6,12H,7-11H2,1-2H3,(H2,24,30)(H,25,29) |
| InChIKey | CINKHTFPBKYULY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |