C22H31N5O2S2 — CID 17303974
2-[[2-[[5-(cyclohexylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17303974) has the molecular formula C22H31N5O2S2 and a molecular weight of 461.66 g/mol. Its IUPAC name is 2-[[2-[[5-(cyclohexylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(cyclohexylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17303974 |
| Molecular Formula | C22H31N5O2S2 |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-[[2-[[5-(cyclohexylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)CSc3nnc(CC4CCCCC4)n3C)c2C(N)=O)C1 |
| InChI | InChI=1S/C22H31N5O2S2/c1-13-8-9-15-16(10-13)31-21(19(15)20(23)29)24-18(28)12-30-22-26-25-17(27(22)2)11-14-6-4-3-5-7-14/h13-14H,3-12H2,1-2H3,(H2,23,29)(H,24,28) |
| InChIKey | JTYBFMPFISYKKB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |