C17H21N5O3S2 — CID 9347302
(6S)-2-[[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 9347302) has the molecular formula C17H21N5O3S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (6S)-2-[[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-2-[[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 9347302 |
| Molecular Formula | C17H21N5O3S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (6S)-2-[[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C[C@H]1CCc2c(sc(NC(=O)CSc3n[nH]c(=O)n3C3CC3)c2C(N)=O)C1 |
| InChI | InChI=1S/C17H21N5O3S2/c1-8-2-5-10-11(6-8)27-15(13(10)14(18)24)19-12(23)7-26-17-21-20-16(25)22(17)9-3-4-9/h8-9H,2-7H2,1H3,(H2,18,24)(H,19,23)(H,20,25)/t8-/m0/s1 |
| InChIKey | AYWMMRKOLKRCRC-QMMMGPOBSA-N |
| XLogP | 1.92 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |