C27H32N4O4S2 — CID 21165468
ethyl 6-methyl-2-[[2-[[5-[(4-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 21165468) has the molecular formula C27H32N4O4S2 and a molecular weight of 540.71 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-[[5-[(4-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-[[5-[(4-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 21165468 |
| Molecular Formula | C27H32N4O4S2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | ethyl 6-methyl-2-[[2-[[5-[(4-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2ccc(C)cc2)nnc1SCC(=O)Nc1sc2c(c1C(=O)OCC)CCC(C)C2 |
| InChI | InChI=1S/C27H32N4O4S2/c1-5-13-31-22(15-35-19-10-7-17(3)8-11-19)29-30-27(31)36-16-23(32)28-25-24(26(33)34-6-2)20-12-9-18(4)14-21(20)37-25/h5,7-8,10-11,18H,1,6,9,12-16H2,2-4H3,(H,28,32) |
| InChIKey | PDRNCYUXYRAPCQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|