C27H29F3N4O4S2 — CID 17267815
ethyl 6-methyl-2-[[2-[[4-prop-2-enyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17267815) has the molecular formula C27H29F3N4O4S2 and a molecular weight of 594.68 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-[[4-prop-2-enyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-[[4-prop-2-enyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17267815 |
| Molecular Formula | C27H29F3N4O4S2 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | ethyl 6-methyl-2-[[2-[[4-prop-2-enyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2cccc(C(F)(F)F)c2)nnc1SCC(=O)Nc1sc2c(c1C(=O)OCC)CCC(C)C2 |
| InChI | InChI=1S/C27H29F3N4O4S2/c1-4-11-34-21(14-38-18-8-6-7-17(13-18)27(28,29)30)32-33-26(34)39-15-22(35)31-24-23(25(36)37-5-2)19-10-9-16(3)12-20(19)40-24/h4,6-8,13,16H,1,5,9-12,14-15H2,2-3H3,(H,31,35) |
| InChIKey | AFOIAZNJGDNHND-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|