C28H34N4O4S2 — CID 19632249
ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19632249) has the molecular formula C28H34N4O4S2 and a molecular weight of 554.74 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19632249 |
| Molecular Formula | C28H34N4O4S2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2ccc(CC)cc2)nnc1SCC(=O)Nc1sc2c(c1C(=O)OCC)CCC(C)C2 |
| InChI | InChI=1S/C28H34N4O4S2/c1-5-14-32-23(16-36-20-11-9-19(6-2)10-12-20)30-31-28(32)37-17-24(33)29-26-25(27(34)35-7-3)21-13-8-18(4)15-22(21)38-26/h5,9-12,18H,1,6-8,13-17H2,2-4H3,(H,29,33) |
| InChIKey | RCNIZHCBIOXQPU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|