C25H27FN4OS — CID 112784639
1-(4-benzylpiperidin-1-yl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 112784639) has the molecular formula C25H27FN4OS and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 112784639 |
| Molecular Formula | C25H27FN4OS |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | C=CCn1c(SCC(=O)N2CCC(Cc3ccccc3)CC2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C25H27FN4OS/c1-2-14-30-24(21-10-6-7-11-22(21)26)27-28-25(30)32-18-23(31)29-15-12-20(13-16-29)17-19-8-4-3-5-9-19/h2-11,20H,1,12-18H2 |
| InChIKey | CCYURTUXVKRZRP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|