C30H32F3N5O2S — CID 5023279
N-(1-benzylpiperidin-4-yl)-5-[[5-(furan-2-yl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]pentanamide (PubChem CID 5023279) has the molecular formula C30H32F3N5O2S and a molecular weight of 583.68 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-[[5-(furan-2-yl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-[[5-(furan-2-yl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 5023279 |
| Molecular Formula | C30H32F3N5O2S |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-[[5-(furan-2-yl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
| SMILES | O=C(CCCCSc1nnc(-c2ccco2)n1-c1cccc(C(F)(F)F)c1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H32F3N5O2S/c31-30(32,33)23-10-6-11-25(20-23)38-28(26-12-7-18-40-26)35-36-29(38)41-19-5-4-13-27(39)34-24-14-16-37(17-15-24)21-22-8-2-1-3-9-22/h1-3,6-12,18,20,24H,4-5,13-17,19,21H2,(H,34,39) |
| InChIKey | YIOZPIQKMOHQLD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|