C25H26ClN3O3S — CID 92677391
N-[4-(4-benzhydrylpiperazine-1-carbonyl)-3-chlorophenyl]methanesulfonamide (PubChem CID 92677391) has the molecular formula C25H26ClN3O3S and a molecular weight of 484.02 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazine-1-carbonyl)-3-chlorophenyl]methanesulfonamide.
| Compound Name | N-[4-(4-benzhydrylpiperazine-1-carbonyl)-3-chlorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 92677391 |
| Molecular Formula | C25H26ClN3O3S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazine-1-carbonyl)-3-chlorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C25H26ClN3O3S/c1-33(31,32)27-21-12-13-22(23(26)18-21)25(30)29-16-14-28(15-17-29)24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-13,18,24,27H,14-17H2,1H3 |
| InChIKey | YJEHVWKILYKOQY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |