C11H16N4O — CID 62156557
(2-amino-3-pyridinyl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 62156557) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is (2-amino-3-pyridinyl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | (2-amino-3-pyridinyl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 62156557 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2-amino-3-pyridinyl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cccnc2N)CC1 |
| InChI | InChI=1S/C11H16N4O/c1-14-5-7-15(8-6-14)11(16)9-3-2-4-13-10(9)12/h2-4H,5-8H2,1H3,(H2,12,13) |
| InChIKey | IJNXACCAIRGJCJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |