C11H15FN4O3S — CID 105386166
(2-amino-3-fluoro-4-pyridinyl)-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 105386166) has the molecular formula C11H15FN4O3S and a molecular weight of 302.33 g/mol. Its IUPAC name is (2-amino-3-fluoro-4-pyridinyl)-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (2-amino-3-fluoro-4-pyridinyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 105386166 |
| Molecular Formula | C11H15FN4O3S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (2-amino-3-fluoro-4-pyridinyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2ccnc(N)c2F)CC1 |
| InChI | InChI=1S/C11H15FN4O3S/c1-20(18,19)16-6-4-15(5-7-16)11(17)8-2-3-14-10(13)9(8)12/h2-3H,4-7H2,1H3,(H2,13,14) |
| InChIKey | XHTIWOQBIVYUBB-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |