C11H17N5O3S2 — CID 106678701
2-(3-aminopyrazin-2-yl)sulfanyl-1-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 106678701) has the molecular formula C11H17N5O3S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanyl-1-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanyl-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 106678701 |
| Molecular Formula | C11H17N5O3S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanyl-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CSc2nccnc2N)CC1 |
| InChI | InChI=1S/C11H17N5O3S2/c1-21(18,19)16-6-4-15(5-7-16)9(17)8-20-11-10(12)13-2-3-14-11/h2-3H,4-8H2,1H3,(H2,12,13) |
| InChIKey | OJMCNHOASSYHQC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |