C10H15N5OS — CID 106679402
2-(3-aminopyrazin-2-yl)sulfanyl-1-piperazin-1-ylethanone (PubChem CID 106679402) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanyl-1-piperazin-1-ylethanone.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanyl-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 106679402 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanyl-1-piperazin-1-ylethanone |
| SMILES | Nc1nccnc1SCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H15N5OS/c11-9-10(14-2-1-13-9)17-7-8(16)15-5-3-12-4-6-15/h1-2,12H,3-7H2,(H2,11,13) |
| InChIKey | PNLAZXYJPLVHAZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |