C11H15ClN4OS — CID 114236383
2-(6-amino-5-chloropyrimidin-4-yl)sulfanyl-1-piperidin-1-ylethanone (PubChem CID 114236383) has the molecular formula C11H15ClN4OS and a molecular weight of 286.79 g/mol. Its IUPAC name is 2-(6-amino-5-chloropyrimidin-4-yl)sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-(6-amino-5-chloropyrimidin-4-yl)sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 114236383 |
| Molecular Formula | C11H15ClN4OS |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(6-amino-5-chloropyrimidin-4-yl)sulfanyl-1-piperidin-1-ylethanone |
| SMILES | Nc1ncnc(SCC(=O)N2CCCCC2)c1Cl |
| InChI | InChI=1S/C11H15ClN4OS/c12-9-10(13)14-7-15-11(9)18-6-8(17)16-4-2-1-3-5-16/h7H,1-6H2,(H2,13,14,15) |
| InChIKey | PDQWMNUGYHWODR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |