C12H16N4OS — CID 106678756
2-(3-aminopyrazin-2-yl)sulfanyl-N,N-bis(prop-2-enyl)acetamide (PubChem CID 106678756) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanyl-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 106678756 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1nccnc1N |
| InChI | InChI=1S/C12H16N4OS/c1-3-7-16(8-4-2)10(17)9-18-12-11(13)14-5-6-15-12/h3-6H,1-2,7-9H2,(H2,13,14) |
| InChIKey | NTYNCUYTKRGPQS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|