C13H17N3OS — CID 43301312
2-[(5-amino-2-pyridinyl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 43301312) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[(5-amino-2-pyridinyl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 43301312 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1ccc(N)cn1 |
| InChI | InChI=1S/C13H17N3OS/c1-3-7-16(8-4-2)13(17)10-18-12-6-5-11(14)9-15-12/h3-6,9H,1-2,7-8,10,14H2 |
| InChIKey | IKYQHBNURKLJHP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|