C15H20N2O4 — CID 105064219
ethyl 1-(3-methoxypyridine-4-carbonyl)piperidine-4-carboxylate (PubChem CID 105064219) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is ethyl 1-(3-methoxypyridine-4-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-methoxypyridine-4-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 105064219 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 1-(3-methoxypyridine-4-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccncc2OC)CC1 |
| InChI | InChI=1S/C15H20N2O4/c1-3-21-15(19)11-5-8-17(9-6-11)14(18)12-4-7-16-10-13(12)20-2/h4,7,10-11H,3,5-6,8-9H2,1-2H3 |
| InChIKey | UZZVZZGVCVAVST-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |