C18H25NO5 — CID 110763374
ethyl 1-(2,4-dimethoxy-3-methylbenzoyl)piperidine-4-carboxylate (PubChem CID 110763374) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl 1-(2,4-dimethoxy-3-methylbenzoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2,4-dimethoxy-3-methylbenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 110763374 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | ethyl 1-(2,4-dimethoxy-3-methylbenzoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(OC)c(C)c2OC)CC1 |
| InChI | InChI=1S/C18H25NO5/c1-5-24-18(21)13-8-10-19(11-9-13)17(20)14-6-7-15(22-3)12(2)16(14)23-4/h6-7,13H,5,8-11H2,1-4H3 |
| InChIKey | DVLMNUUANBAVOK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |