C18H25NO4 — CID 110761989
ethyl 1-(5-ethyl-2-methoxybenzoyl)piperidine-4-carboxylate (PubChem CID 110761989) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is ethyl 1-(5-ethyl-2-methoxybenzoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-ethyl-2-methoxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 110761989 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethyl 1-(5-ethyl-2-methoxybenzoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc(CC)ccc2OC)CC1 |
| InChI | InChI=1S/C18H25NO4/c1-4-13-6-7-16(22-3)15(12-13)17(20)19-10-8-14(9-11-19)18(21)23-5-2/h6-7,12,14H,4-5,8-11H2,1-3H3 |
| InChIKey | HTWGLUXJGMDLMR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |