C20H28N2O3 — CID 110801618
cyclopentyl-[4-(5-ethyl-2-methoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 110801618) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is cyclopentyl-[4-(5-ethyl-2-methoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-(5-ethyl-2-methoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110801618 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | cyclopentyl-[4-(5-ethyl-2-methoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(OC)c(C(=O)N2CCN(C(=O)C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C20H28N2O3/c1-3-15-8-9-18(25-2)17(14-15)20(24)22-12-10-21(11-13-22)19(23)16-6-4-5-7-16/h8-9,14,16H,3-7,10-13H2,1-2H3 |
| InChIKey | ZFJJNDLCMFFYCX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |