C18H24N2O5 — CID 166241313
(5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl 1-(furan-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 166241313) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is (5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl 1-(furan-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | (5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl 1-(furan-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 166241313 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (5-oxo-1-propan-2-ylpyrrolidin-3-yl)methyl 1-(furan-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)N1CC(COC(=O)C2CCCN2C(=O)c2ccco2)CC1=O |
| InChI | InChI=1S/C18H24N2O5/c1-12(2)20-10-13(9-16(20)21)11-25-18(23)14-5-3-7-19(14)17(22)15-6-4-8-24-15/h4,6,8,12-14H,3,5,7,9-11H2,1-2H3 |
| InChIKey | PJTAWPRMBRFPAP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |