C19H16N2O5 — CID 55979205
1-(furan-2-carbonyl)-N-(2-oxochromen-6-yl)pyrrolidine-2-carboxamide (PubChem CID 55979205) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-(2-oxochromen-6-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-(2-oxochromen-6-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55979205 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-(2-oxochromen-6-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)ccc2c1)C1CCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C19H16N2O5/c22-17-8-5-12-11-13(6-7-15(12)26-17)20-18(23)14-3-1-9-21(14)19(24)16-4-2-10-25-16/h2,4-8,10-11,14H,1,3,9H2,(H,20,23) |
| InChIKey | SUURNXSHHSKFMJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|