C19H22N2O5 — CID 60559831
tert-butyl 2-[(2-oxochromen-6-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 60559831) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is tert-butyl 2-[(2-oxochromen-6-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2-oxochromen-6-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 60559831 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | tert-butyl 2-[(2-oxochromen-6-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C19H22N2O5/c1-19(2,3)26-18(24)21-10-4-5-14(21)17(23)20-13-7-8-15-12(11-13)6-9-16(22)25-15/h6-9,11,14H,4-5,10H2,1-3H3,(H,20,23) |
| InChIKey | HYXXNEDHJORGRT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|