C16H28N2O4S — CID 124782945
1-[(5aR,8aR)-4-(cyclopentylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-methylsulfonylethanone (PubChem CID 124782945) has the molecular formula C16H28N2O4S and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-[(5aR,8aR)-4-(cyclopentylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[(5aR,8aR)-4-(cyclopentylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 124782945 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(5aR,8aR)-4-(cyclopentylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-methylsulfonylethanone |
| SMILES | CS(=O)(=O)CC(=O)N1C[C@H]2CN(CC3CCCC3)CCO[C@H]2C1 |
| InChI | InChI=1S/C16H28N2O4S/c1-23(20,21)12-16(19)18-10-14-9-17(6-7-22-15(14)11-18)8-13-4-2-3-5-13/h13-15H,2-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | KVZXBPXWRMNHAF-CABCVRRESA-N |
| XLogP | 0.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |