C13H24N2O — CID 125201705
(5aS,8aR)-4-(cyclopentylmethyl)-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine (PubChem CID 125201705) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (5aS,8aR)-4-(cyclopentylmethyl)-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine.
| Compound Name | (5aS,8aR)-4-(cyclopentylmethyl)-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine |
|---|---|
| PubChem CID | 125201705 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (5aS,8aR)-4-(cyclopentylmethyl)-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine |
| SMILES | C1CCC(CN2CCO[C@H]3CNC[C@H]3C2)C1 |
| InChI | InChI=1S/C13H24N2O/c1-2-4-11(3-1)9-15-5-6-16-13-8-14-7-12(13)10-15/h11-14H,1-10H2/t12-,13-/m0/s1 |
| InChIKey | VFLNSXFFGRZZKN-STQMWFEESA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |