C20H29F3N4O3 — CID 155863197
4-(cyclopropylmethyl)-8-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;2,2,2-trifluoroacetic acid (PubChem CID 155863197) has the molecular formula C20H29F3N4O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-8-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(cyclopropylmethyl)-8-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155863197 |
| Molecular Formula | C20H29F3N4O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 4-(cyclopropylmethyl)-8-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cnc(N2CCC3CN(CC4CC4)CCOC3C2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O.C2HF3O2/c1-2-14-9-19-18(20-10-14)22-6-5-16-12-21(11-15-3-4-15)7-8-23-17(16)13-22;3-2(4,5)1(6)7/h9-10,15-17H,2-8,11-13H2,1H3;(H,6,7) |
| InChIKey | BCLDDPASMLYZGJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |