C14H21N3 — CID 66837618
(7aR)-2-(5-ethylpyrimidin-2-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridine (PubChem CID 66837618) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (7aR)-2-(5-ethylpyrimidin-2-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridine.
| Compound Name | (7aR)-2-(5-ethylpyrimidin-2-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridine |
|---|---|
| PubChem CID | 66837618 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (7aR)-2-(5-ethylpyrimidin-2-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridine |
| SMILES | CCc1cnc(N2CCC3CCC[C@H]3C2)nc1 |
| InChI | InChI=1S/C14H21N3/c1-2-11-8-15-14(16-9-11)17-7-6-12-4-3-5-13(12)10-17/h8-9,12-13H,2-7,10H2,1H3/t12?,13-/m0/s1 |
| InChIKey | BTBJQLNTUIURDZ-ABLWVSNPSA-N |
| XLogP | 2.67 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |