C20H30N4O2 — CID 131690974
[(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylcyclobutyl)methanone (PubChem CID 131690974) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is [(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylcyclobutyl)methanone.
| Compound Name | [(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylcyclobutyl)methanone |
|---|---|
| PubChem CID | 131690974 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | [(5aR,9aS)-4-(5-ethylpyrimidin-2-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(3-methylcyclobutyl)methanone |
| SMILES | CCc1cnc(N2CCO[C@@H]3CN(C(=O)C4CC(C)C4)CC[C@@H]3C2)nc1 |
| InChI | InChI=1S/C20H30N4O2/c1-3-15-10-21-20(22-11-15)24-6-7-26-18-13-23(5-4-16(18)12-24)19(25)17-8-14(2)9-17/h10-11,14,16-18H,3-9,12-13H2,1-2H3/t14?,16-,17?,18-/m1/s1 |
| InChIKey | LGMCERFGKZCMEZ-XYQBIQKZSA-N |
| XLogP | 2.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |